About N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine
N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine (PubChem CID 177288460) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine.
Molecular Properties
| Compound Name | N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine |
| PubChem CID | 177288460 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine |
| SMILES | CC(C)(C)/C=N/c1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H23N/c1-14(2,3)11-16-13-9-7-8-12(10-13)15(4,5)6/h7-11H,1-6H3/b16-11+ |
| InChIKey | YCJQXRMJGNOFAJ-LFIBNONCSA-N |
| XLogP | 4.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine?
The IUPAC name of N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine (CID 177288460) is N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine.
What is the SMILES notation for N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine?
The canonical SMILES for N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine is CC(C)(C)/C=N/c1cccc(C(C)(C)C)c1.
What is the InChIKey of N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine?
The InChIKey is YCJQXRMJGNOFAJ-LFIBNONCSA-N. The full InChI is InChI=1S/C15H23N/c1-14(2,3)11-16-13-9-7-8-12(10-13)15(4,5)6/h7-11H,1-6H3/b16-11+.
What are the key properties of N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine?
N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine has a molecular weight of 217.36 g/mol, XLogP of 4.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-tert-butylphenyl)-2,2-dimethylpropan-1-imine is sourced from PubChem (CID 177288460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).