C27H38FN5O5 — CID 177288555
tert-butyl 3-(2,2-dimethoxyethylcarbamoylamino)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene-12-carboxylate (PubChem CID 177288555) has the molecular formula C27H38FN5O5 and a molecular weight of 531.63 g/mol. Its IUPAC name is tert-butyl 3-(2,2-dimethoxyethylcarbamoylamino)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene-12-carboxylate.
| Compound Name | tert-butyl 3-(2,2-dimethoxyethylcarbamoylamino)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene-12-carboxylate |
|---|---|
| PubChem CID | 177288555 |
| Molecular Formula | C27H38FN5O5 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | tert-butyl 3-(2,2-dimethoxyethylcarbamoylamino)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene-12-carboxylate |
| SMILES | COC(CNC(=O)Nc1c2c(nn1-c1cc(C)c(F)c(C)c1)CC1CCCC2N1C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C27H38FN5O5/c1-15-11-18(12-16(2)23(15)28)33-24(30-25(34)29-14-21(36-6)37-7)22-19(31-33)13-17-9-8-10-20(22)32(17)26(35)38-27(3,4)5/h11-12,17,20-21H,8-10,13-14H2,1-7H3,(H2,29,30,34) |
| InChIKey | NDVGGROSWTWJLU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|