C20H26N2O4+2 — CID 177289131
5,12-bis(2-methoxyethoxy)-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene (PubChem CID 177289131) has the molecular formula C20H26N2O4+2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 5,12-bis(2-methoxyethoxy)-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene.
| Compound Name | 5,12-bis(2-methoxyethoxy)-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene |
|---|---|
| PubChem CID | 177289131 |
| Molecular Formula | C20H26N2O4+2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 5,12-bis(2-methoxyethoxy)-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene |
| SMILES | COCCOc1cc[n+]2c3c1CC[n+]1ccc(OCCOC)c(c1-3)CC2 |
| InChI | InChI=1S/C20H26N2O4/c1-23-11-13-25-17-5-9-21-8-4-16-18(26-14-12-24-2)6-10-22-7-3-15(17)19(21)20(16)22/h5-6,9-10H,3-4,7-8,11-14H2,1-2H3/q+2 |
| InChIKey | YDZYHLLZAJPUIT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 44.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|