C62H59BrN2 — CID 177290011
9-[2-bromo-5-(3,6-ditert-butylcarbazol-9-yl)-4-pyren-1-ylphenyl]-3,6-ditert-butylcarbazole (PubChem CID 177290011) has the molecular formula C62H59BrN2 and a molecular weight of 912.07 g/mol. Its IUPAC name is 9-[2-bromo-5-(3,6-ditert-butylcarbazol-9-yl)-4-pyren-1-ylphenyl]-3,6-ditert-butylcarbazole.
| Compound Name | 9-[2-bromo-5-(3,6-ditert-butylcarbazol-9-yl)-4-pyren-1-ylphenyl]-3,6-ditert-butylcarbazole |
|---|---|
| PubChem CID | 177290011 |
| Molecular Formula | C62H59BrN2 |
| Molecular Weight | 912.07 g/mol |
| Exact Mass | 910.39 |
| IUPAC Name | 9-[2-bromo-5-(3,6-ditert-butylcarbazol-9-yl)-4-pyren-1-ylphenyl]-3,6-ditert-butylcarbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c(-c2ccc3ccc4cccc5ccc2c3c45)cc1Br |
| InChI | InChI=1S/C62H59BrN2/c1-59(2,3)39-20-26-51-45(30-39)46-31-40(60(4,5)6)21-27-52(46)64(51)55-35-56(65-53-28-22-41(61(7,8)9)32-47(53)48-33-42(62(10,11)12)23-29-54(48)65)50(63)34-49(55)43-24-18-38-17-16-36-14-13-15-37-19-25-44(43)58(38)57(36)37/h13-35H,1-12H3 |
| InChIKey | STXYUGBSEZPXEG-UHFFFAOYSA-N |
| XLogP | 18.40 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.07 |
| LogP ≤ 5 | 18.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|