C27H38N2O5 — CID 177290604
methyl (2R,3R,6S)-2-[2-[4-(anilinomethyl)piperidin-1-yl]-2-oxoethyl]-3-methyl-5-methylidene-6-(2-methylpropyl)-4-oxooxane-3-carboxylate (PubChem CID 177290604) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is methyl (2R,3R,6S)-2-[2-[4-(anilinomethyl)piperidin-1-yl]-2-oxoethyl]-3-methyl-5-methylidene-6-(2-methylpropyl)-4-oxooxane-3-carboxylate.
| Compound Name | methyl (2R,3R,6S)-2-[2-[4-(anilinomethyl)piperidin-1-yl]-2-oxoethyl]-3-methyl-5-methylidene-6-(2-methylpropyl)-4-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 177290604 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | methyl (2R,3R,6S)-2-[2-[4-(anilinomethyl)piperidin-1-yl]-2-oxoethyl]-3-methyl-5-methylidene-6-(2-methylpropyl)-4-oxooxane-3-carboxylate |
| SMILES | C=C1C(=O)[C@](C)(C(=O)OC)[C@@H](CC(=O)N2CCC(CNc3ccccc3)CC2)O[C@H]1CC(C)C |
| InChI | InChI=1S/C27H38N2O5/c1-18(2)15-22-19(3)25(31)27(4,26(32)33-5)23(34-22)16-24(30)29-13-11-20(12-14-29)17-28-21-9-7-6-8-10-21/h6-10,18,20,22-23,28H,3,11-17H2,1-2,4-5H3/t22-,23+,27+/m0/s1 |
| InChIKey | LRHOOOGAXPHDQK-QHWMMSMNSA-N |
| XLogP | 3.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|