C34H32FN9O — CID 177290611
3-benzyl-1-[1-[[5-cyano-4-(4-fluorophenyl)pyrimidin-2-yl]amino]cyclohexyl]-1-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]urea (PubChem CID 177290611) has the molecular formula C34H32FN9O and a molecular weight of 601.69 g/mol. Its IUPAC name is 3-benzyl-1-[1-[[5-cyano-4-(4-fluorophenyl)pyrimidin-2-yl]amino]cyclohexyl]-1-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]urea.
| Compound Name | 3-benzyl-1-[1-[[5-cyano-4-(4-fluorophenyl)pyrimidin-2-yl]amino]cyclohexyl]-1-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 177290611 |
| Molecular Formula | C34H32FN9O |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | 3-benzyl-1-[1-[[5-cyano-4-(4-fluorophenyl)pyrimidin-2-yl]amino]cyclohexyl]-1-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]urea |
| SMILES | Cn1cc(-c2ccc(N(C(=O)NCc3ccccc3)C3(Nc4ncc(C#N)c(-c5ccc(F)cc5)n4)CCCCC3)nc2)cn1 |
| InChI | InChI=1S/C34H32FN9O/c1-43-23-28(22-40-43)26-12-15-30(37-20-26)44(33(45)39-19-24-8-4-2-5-9-24)34(16-6-3-7-17-34)42-32-38-21-27(18-36)31(41-32)25-10-13-29(35)14-11-25/h2,4-5,8-15,20-23H,3,6-7,16-17,19H2,1H3,(H,39,45)(H,38,41,42) |
| InChIKey | FLPDBJUIHNXGCK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 124.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|