C32H34F3N9O3 — CID 177290615
2-benzyl-1-[5-(2-methoxypyrimidin-5-yl)-2-pyridinyl]-1-[4-[[4-(oxetan-3-yloxy)-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclohexyl]guanidine (PubChem CID 177290615) has the molecular formula C32H34F3N9O3 and a molecular weight of 649.68 g/mol. Its IUPAC name is 2-benzyl-1-[5-(2-methoxypyrimidin-5-yl)-2-pyridinyl]-1-[4-[[4-(oxetan-3-yloxy)-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclohexyl]guanidine.
| Compound Name | 2-benzyl-1-[5-(2-methoxypyrimidin-5-yl)-2-pyridinyl]-1-[4-[[4-(oxetan-3-yloxy)-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclohexyl]guanidine |
|---|---|
| PubChem CID | 177290615 |
| Molecular Formula | C32H34F3N9O3 |
| Molecular Weight | 649.68 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | 2-benzyl-1-[5-(2-methoxypyrimidin-5-yl)-2-pyridinyl]-1-[4-[[4-(oxetan-3-yloxy)-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclohexyl]guanidine |
| SMILES | COc1ncc(-c2ccc(N(/C(N)=N/Cc3ccccc3)C3CCC(Nc4ncc(C(F)(F)F)c(OC5COC5)n4)CC3)nc2)cn1 |
| InChI | InChI=1S/C32H34F3N9O3/c1-45-31-40-15-22(16-41-31)21-7-12-27(37-14-21)44(29(36)38-13-20-5-3-2-4-6-20)24-10-8-23(9-11-24)42-30-39-17-26(32(33,34)35)28(43-30)47-25-18-46-19-25/h2-7,12,14-17,23-25H,8-11,13,18-19H2,1H3,(H2,36,38)(H,39,42,43) |
| InChIKey | VCECVUIEVFGDHD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|