C21H19BrN4S — CID 177290839
2-[(1E,3E)-4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)buta-1,3-dienyl]-6-bromo-[1,3]thiazolo[4,5-b]pyrazine (PubChem CID 177290839) has the molecular formula C21H19BrN4S and a molecular weight of 439.38 g/mol. Its IUPAC name is 2-[(1E,3E)-4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)buta-1,3-dienyl]-6-bromo-[1,3]thiazolo[4,5-b]pyrazine.
| Compound Name | 2-[(1E,3E)-4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)buta-1,3-dienyl]-6-bromo-[1,3]thiazolo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 177290839 |
| Molecular Formula | C21H19BrN4S |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 2-[(1E,3E)-4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)buta-1,3-dienyl]-6-bromo-[1,3]thiazolo[4,5-b]pyrazine |
| SMILES | Brc1cnc2nc(/C=C/C=C/c3cc4c5c(c3)CCCN5CCC4)sc2n1 |
| InChI | InChI=1S/C21H19BrN4S/c22-17-13-23-20-21(24-17)27-18(25-20)8-2-1-5-14-11-15-6-3-9-26-10-4-7-16(12-14)19(15)26/h1-2,5,8,11-13H,3-4,6-7,9-10H2/b5-1+,8-2+ |
| InChIKey | WLUDSJMGTHXXOJ-FBLJAGBRSA-N |
| XLogP | 5.27 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|