C24H17F2O12S- — CID 177295115
1,1-difluoro-2-oxo-2-[[2-[(5-oxo-9-phenoxycarbonyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]phenyl]methoxy]ethanesulfonate (PubChem CID 177295115) has the molecular formula C24H17F2O12S- and a molecular weight of 567.45 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[[2-[(5-oxo-9-phenoxycarbonyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]phenyl]methoxy]ethanesulfonate.
| Compound Name | 1,1-difluoro-2-oxo-2-[[2-[(5-oxo-9-phenoxycarbonyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]phenyl]methoxy]ethanesulfonate |
|---|---|
| PubChem CID | 177295115 |
| Molecular Formula | C24H17F2O12S- |
| Molecular Weight | 567.45 g/mol |
| Exact Mass | 567.04 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[[2-[(5-oxo-9-phenoxycarbonyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl]phenyl]methoxy]ethanesulfonate |
| SMILES | O=C(OC1C2OC(=O)C3C2OC1C3C(=O)Oc1ccccc1)c1ccccc1COC(=O)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C24H18F2O12S/c25-24(26,39(31,32)33)23(30)34-10-11-6-4-5-9-13(11)20(27)37-18-16-14(15-17(36-16)19(18)38-22(15)29)21(28)35-12-7-2-1-3-8-12/h1-9,14-19H,10H2,(H,31,32,33)/p-1 |
| InChIKey | VKNGEAWWGKRHPM-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 171.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|