C29H30F4N8O4 — CID 177295475
8-[4-[4-[[3-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxyoctanamide (PubChem CID 177295475) has the molecular formula C29H30F4N8O4 and a molecular weight of 630.60 g/mol. Its IUPAC name is 8-[4-[4-[[3-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxyoctanamide.
| Compound Name | 8-[4-[4-[[3-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxyoctanamide |
|---|---|
| PubChem CID | 177295475 |
| Molecular Formula | C29H30F4N8O4 |
| Molecular Weight | 630.60 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 8-[4-[4-[[3-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxyoctanamide |
| SMILES | CC1(C)C(=O)N(c2cnc(C#N)c(C(F)(F)F)c2)C(=O)N1Cc1ccc(-c2cn(CCCCCCCC(=O)NO)nn2)cc1F |
| InChI | InChI=1S/C29H30F4N8O4/c1-28(2)26(43)41(20-13-21(29(31,32)33)23(14-34)35-15-20)27(44)40(28)16-19-10-9-18(12-22(19)30)24-17-39(38-36-24)11-7-5-3-4-6-8-25(42)37-45/h9-10,12-13,15,17,45H,3-8,11,16H2,1-2H3,(H,37,42) |
| InChIKey | BBHAQCSSMRSTHE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|