C28H26F4N8O4 — CID 177295491
6-[4-[4-[[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-6,8-dioxo-5,7-diazaspiro[3.4]octan-5-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxyhexanamide (PubChem CID 177295491) has the molecular formula C28H26F4N8O4 and a molecular weight of 614.56 g/mol. Its IUPAC name is 6-[4-[4-[[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-6,8-dioxo-5,7-diazaspiro[3.4]octan-5-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxyhexanamide.
| Compound Name | 6-[4-[4-[[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-6,8-dioxo-5,7-diazaspiro[3.4]octan-5-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 177295491 |
| Molecular Formula | C28H26F4N8O4 |
| Molecular Weight | 614.56 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | 6-[4-[4-[[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-6,8-dioxo-5,7-diazaspiro[3.4]octan-5-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxyhexanamide |
| SMILES | N#Cc1ncc(N2C(=O)N(Cc3ccc(-c4cn(CCCCCC(=O)NO)nn4)cc3F)C3(CCC3)C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C28H26F4N8O4/c29-21-11-17(23-16-38(37-35-23)10-3-1-2-5-24(41)36-44)6-7-18(21)15-39-26(43)40(25(42)27(39)8-4-9-27)19-12-20(28(30,31)32)22(13-33)34-14-19/h6-7,11-12,14,16,44H,1-5,8-10,15H2,(H,36,41) |
| InChIKey | CKJKFADBGQBXQL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|