C14H18BrCl2NO — CID 177295929
N-(3-bromo-2,4-dichlorophenyl)octanamide (PubChem CID 177295929) has the molecular formula C14H18BrCl2NO and a molecular weight of 367.11 g/mol. Its IUPAC name is N-(3-bromo-2,4-dichlorophenyl)octanamide.
| Compound Name | N-(3-bromo-2,4-dichlorophenyl)octanamide |
|---|---|
| PubChem CID | 177295929 |
| Molecular Formula | C14H18BrCl2NO |
| Molecular Weight | 367.11 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | N-(3-bromo-2,4-dichlorophenyl)octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(Cl)c(Br)c1Cl |
| InChI | InChI=1S/C14H18BrCl2NO/c1-2-3-4-5-6-7-12(19)18-11-9-8-10(16)13(15)14(11)17/h8-9H,2-7H2,1H3,(H,18,19) |
| InChIKey | VCZSUBIXKPYWDL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.11 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|