C17H19N7O2 — CID 177296047
N-[(4R)-2-(2-methoxy-4-pyridinyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-4-yl]-2,5-dimethyl-1,2,4-triazole-3-carboxamide (PubChem CID 177296047) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is N-[(4R)-2-(2-methoxy-4-pyridinyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-4-yl]-2,5-dimethyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(4R)-2-(2-methoxy-4-pyridinyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-4-yl]-2,5-dimethyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 177296047 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-[(4R)-2-(2-methoxy-4-pyridinyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-4-yl]-2,5-dimethyl-1,2,4-triazole-3-carboxamide |
| SMILES | COc1cc(-c2cc3n(n2)CC[C@H]3NC(=O)c2nc(C)nn2C)ccn1 |
| InChI | InChI=1S/C17H19N7O2/c1-10-19-16(23(2)21-10)17(25)20-12-5-7-24-14(12)9-13(22-24)11-4-6-18-15(8-11)26-3/h4,6,8-9,12H,5,7H2,1-3H3,(H,20,25)/t12-/m1/s1 |
| InChIKey | ZYNDLUOFJJBDTC-GFCCVEGCSA-N |
| XLogP | 1.27 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |