C20H16FN5O3 — CID 177297466
(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-[(4S)-4-(7-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone (PubChem CID 177297466) has the molecular formula C20H16FN5O3 and a molecular weight of 393.38 g/mol. Its IUPAC name is (5-cyclopropyl-1,3,4-oxadiazol-2-yl)-[(4S)-4-(7-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | (5-cyclopropyl-1,3,4-oxadiazol-2-yl)-[(4S)-4-(7-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 177297466 |
| Molecular Formula | C20H16FN5O3 |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (5-cyclopropyl-1,3,4-oxadiazol-2-yl)-[(4S)-4-(7-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
| SMILES | O=C(c1nnc(C2CC2)o1)N1CCc2[nH]cnc2[C@H]1c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C20H16FN5O3/c21-12-3-1-2-11-8-14(28-17(11)12)16-15-13(22-9-23-15)6-7-26(16)20(27)19-25-24-18(29-19)10-4-5-10/h1-3,8-10,16H,4-7H2,(H,22,23)/t16-/m1/s1 |
| InChIKey | GJTCKHHNKDMDTF-MRXNPFEDSA-N |
| XLogP | 3.34 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |