C34H20O2 — CID 177299074
3,4,5,6,10,11,12,14,16-nonadeuterio-15-(2,3,4,5-tetradeuterio-6-dibenzofuran-1-ylphenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene (PubChem CID 177299074) has the molecular formula C34H20O2 and a molecular weight of 473.61 g/mol. Its IUPAC name is 3,4,5,6,10,11,12,14,16-nonadeuterio-15-(2,3,4,5-tetradeuterio-6-dibenzofuran-1-ylphenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene.
| Compound Name | 3,4,5,6,10,11,12,14,16-nonadeuterio-15-(2,3,4,5-tetradeuterio-6-dibenzofuran-1-ylphenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
|---|---|
| PubChem CID | 177299074 |
| Molecular Formula | C34H20O2 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 3,4,5,6,10,11,12,14,16-nonadeuterio-15-(2,3,4,5-tetradeuterio-6-dibenzofuran-1-ylphenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])Oc1c([2H])c([2H])c([2H])c3c([2H])c(-c4c([2H])c([2H])c([2H])c([2H])c4-c4cccc5oc6ccccc6c45)c([2H])c-2c13 |
| InChI | InChI=1S/C34H20O2/c1-2-11-24(26-14-8-18-32-34(26)27-13-4-6-16-30(27)36-32)23(10-1)22-19-21-9-7-17-31-33(21)28(20-22)25-12-3-5-15-29(25)35-31/h1-20H/i1D,2D,3D,5D,7D,9D,10D,11D,12D,15D,17D,19D,20D |
| InChIKey | IOKGELLKNDHIAF-HCNIJMSYSA-N |
| XLogP | 9.85 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |