C23H31N3O5 — CID 177299744
3-methylspiro[8,18-dioxa-6,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-15,5'-morpholine]-3',10-dione (PubChem CID 177299744) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3-methylspiro[8,18-dioxa-6,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-15,5'-morpholine]-3',10-dione.
| Compound Name | 3-methylspiro[8,18-dioxa-6,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-15,5'-morpholine]-3',10-dione |
|---|---|
| PubChem CID | 177299744 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 3-methylspiro[8,18-dioxa-6,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-15,5'-morpholine]-3',10-dione |
| SMILES | Cc1ccnc2c1C1CCC(CC1)OCC1N(CCCC13COCC(=O)N3)C(=O)CO2 |
| InChI | InChI=1S/C23H31N3O5/c1-15-7-9-24-22-21(15)16-3-5-17(6-4-16)30-11-18-23(14-29-12-19(27)25-23)8-2-10-26(18)20(28)13-31-22/h7,9,16-18H,2-6,8,10-14H2,1H3,(H,25,27) |
| InChIKey | QXHLPDROKRFVFA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |