C33H32N6O — CID 177299982
N-[2-(dimethylamino)ethyl]-4-[17-(2-pyridin-4-ylethynyl)-10,15,16-triazatetracyclo[9.7.0.02,8.014,18]octadeca-1(11),2(8),9,12,14,17-hexaen-9-yl]benzamide (PubChem CID 177299982) has the molecular formula C33H32N6O and a molecular weight of 528.66 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[17-(2-pyridin-4-ylethynyl)-10,15,16-triazatetracyclo[9.7.0.02,8.014,18]octadeca-1(11),2(8),9,12,14,17-hexaen-9-yl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[17-(2-pyridin-4-ylethynyl)-10,15,16-triazatetracyclo[9.7.0.02,8.014,18]octadeca-1(11),2(8),9,12,14,17-hexaen-9-yl]benzamide |
|---|---|
| PubChem CID | 177299982 |
| Molecular Formula | C33H32N6O |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[17-(2-pyridin-4-ylethynyl)-10,15,16-triazatetracyclo[9.7.0.02,8.014,18]octadeca-1(11),2(8),9,12,14,17-hexaen-9-yl]benzamide |
| SMILES | CN(C)CCNC(=O)c1ccc(-c2nc3ccc4n[nH]c(C#Cc5ccncc5)c4c3c3c2CCCCC3)cc1 |
| InChI | InChI=1S/C33H32N6O/c1-39(2)21-20-35-33(40)24-11-9-23(10-12-24)32-26-7-5-3-4-6-25(26)30-27(36-32)14-15-29-31(30)28(37-38-29)13-8-22-16-18-34-19-17-22/h9-12,14-19H,3-7,20-21H2,1-2H3,(H,35,40)(H,37,38) |
| InChIKey | NBEXPVMZIMFUTG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|