C32H37F3O3 — CID 177300031
6,6,6-trifluoro-5-[4-[(1R,2S)-6-[(2-methylpropan-2-yl)oxy]-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]hexan-1-ol (PubChem CID 177300031) has the molecular formula C32H37F3O3 and a molecular weight of 526.64 g/mol. Its IUPAC name is 6,6,6-trifluoro-5-[4-[(1R,2S)-6-[(2-methylpropan-2-yl)oxy]-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]hexan-1-ol.
| Compound Name | 6,6,6-trifluoro-5-[4-[(1R,2S)-6-[(2-methylpropan-2-yl)oxy]-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]hexan-1-ol |
|---|---|
| PubChem CID | 177300031 |
| Molecular Formula | C32H37F3O3 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 6,6,6-trifluoro-5-[4-[(1R,2S)-6-[(2-methylpropan-2-yl)oxy]-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]hexan-1-ol |
| SMILES | CC(C)(C)Oc1ccc2c(c1)CC[C@H](c1ccccc1)[C@@H]2c1ccc(OC(CCCCO)C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H37F3O3/c1-31(2,3)38-26-17-19-28-24(21-26)14-18-27(22-9-5-4-6-10-22)30(28)23-12-15-25(16-13-23)37-29(32(33,34)35)11-7-8-20-36/h4-6,9-10,12-13,15-17,19,21,27,29-30,36H,7-8,11,14,18,20H2,1-3H3/t27-,29?,30+/m1/s1 |
| InChIKey | YBDFRVUPKYEYGM-ZFOUTQHZSA-N |
| XLogP | 8.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|