About tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate
tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate (PubChem CID 177300257) has the molecular formula C15H22FN3O4S
and a molecular weight of 359.42 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate |
| PubChem CID | 177300257 |
| Molecular Formula | C15H22FN3O4S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(S(=O)(=O)c2ccccn2)C[C@@H]1F |
| InChI | InChI=1S/C15H22FN3O4S/c1-15(2,3)23-14(20)18-12-7-9-19(10-11(12)16)24(21,22)13-6-4-5-8-17-13/h4-6,8,11-12H,7,9-10H2,1-3H3,(H,18,20)/t11-,12+/m0/s1 |
| InChIKey | PUSSKHXXZAKLPI-NWDGAFQWSA-N |
| XLogP | 1.71 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate?
The IUPAC name of tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate (CID 177300257) is tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate?
The canonical SMILES for tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate is CC(C)(C)OC(=O)N[C@@H]1CCN(S(=O)(=O)c2ccccn2)C[C@@H]1F.
What is the InChIKey of tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate?
The InChIKey is PUSSKHXXZAKLPI-NWDGAFQWSA-N. The full InChI is InChI=1S/C15H22FN3O4S/c1-15(2,3)23-14(20)18-12-7-9-19(10-11(12)16)24(21,22)13-6-4-5-8-17-13/h4-6,8,11-12H,7,9-10H2,1-3H3,(H,18,20)/t11-,12+/m0/s1.
What are the key properties of tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate?
tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate has a molecular weight of 359.42 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3S,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate is sourced from PubChem (CID 177300257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).