C17H31F2N3O — CID 177300837
1-[4-[(3,3-difluoro-4-propan-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]-2-methylpropan-1-one (PubChem CID 177300837) has the molecular formula C17H31F2N3O and a molecular weight of 331.45 g/mol. Its IUPAC name is 1-[4-[(3,3-difluoro-4-propan-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-[(3,3-difluoro-4-propan-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 177300837 |
| Molecular Formula | C17H31F2N3O |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 1-[4-[(3,3-difluoro-4-propan-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCC(CN2CCN(C(C)C)C(F)(F)C2)CC1 |
| InChI | InChI=1S/C17H31F2N3O/c1-13(2)16(23)21-7-5-15(6-8-21)11-20-9-10-22(14(3)4)17(18,19)12-20/h13-15H,5-12H2,1-4H3 |
| InChIKey | IEICZVHPZIZXNU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|