About 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine
2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine (PubChem CID 177304818) has the molecular formula C16H18N2S
and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine |
| PubChem CID | 177304818 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine |
| SMILES | NC1(c2ccccc2)CCc2nc(C3CC3)sc2C1 |
| InChI | InChI=1S/C16H18N2S/c17-16(12-4-2-1-3-5-12)9-8-13-14(10-16)19-15(18-13)11-6-7-11/h1-5,11H,6-10,17H2 |
| InChIKey | KQZPJVJIWWOKCA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine?
The IUPAC name of 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine (CID 177304818) is 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine.
What is the SMILES notation for 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine?
The canonical SMILES for 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine is NC1(c2ccccc2)CCc2nc(C3CC3)sc2C1.
What is the InChIKey of 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine?
The InChIKey is KQZPJVJIWWOKCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2S/c17-16(12-4-2-1-3-5-12)9-8-13-14(10-16)19-15(18-13)11-6-7-11/h1-5,11H,6-10,17H2.
What are the key properties of 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine?
2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine has a molecular weight of 270.40 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-6-phenyl-5,7-dihydro-4H-1,3-benzothiazol-6-amine is sourced from PubChem (CID 177304818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).