About 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine
7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine (PubChem CID 177304925) has the molecular formula C14H15NS
and a molecular weight of 229.35 g/mol. Its IUPAC name is 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine.
Molecular Properties
| Compound Name | 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine |
| PubChem CID | 177304925 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine |
| SMILES | NC1(c2ccccc2)CCCc2ccsc21 |
| InChI | InChI=1S/C14H15NS/c15-14(12-6-2-1-3-7-12)9-4-5-11-8-10-16-13(11)14/h1-3,6-8,10H,4-5,9,15H2 |
| InChIKey | QAMJQSUCUFWKKJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine?
The IUPAC name of 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine (CID 177304925) is 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine.
What is the SMILES notation for 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine?
The canonical SMILES for 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine is NC1(c2ccccc2)CCCc2ccsc21.
What is the InChIKey of 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine?
The InChIKey is QAMJQSUCUFWKKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NS/c15-14(12-6-2-1-3-7-12)9-4-5-11-8-10-16-13(11)14/h1-3,6-8,10H,4-5,9,15H2.
What are the key properties of 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine?
7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine has a molecular weight of 229.35 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenyl-5,6-dihydro-4H-1-benzothiophen-7-amine is sourced from PubChem (CID 177304925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).