C13H15NO2S — CID 177305240
4-[(4S)-3a,4,5,6,7,7a-hexahydrothieno[2,3-c]pyridin-4-yl]benzene-1,2-diol (PubChem CID 177305240) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 4-[(4S)-3a,4,5,6,7,7a-hexahydrothieno[2,3-c]pyridin-4-yl]benzene-1,2-diol.
| Compound Name | 4-[(4S)-3a,4,5,6,7,7a-hexahydrothieno[2,3-c]pyridin-4-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 177305240 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 4-[(4S)-3a,4,5,6,7,7a-hexahydrothieno[2,3-c]pyridin-4-yl]benzene-1,2-diol |
| SMILES | Oc1ccc([C@H]2CNCC3SC=CC32)cc1O |
| InChI | InChI=1S/C13H15NO2S/c15-11-2-1-8(5-12(11)16)10-6-14-7-13-9(10)3-4-17-13/h1-5,9-10,13-16H,6-7H2/t9?,10-,13?/m1/s1 |
| InChIKey | BCWKCHYAQQCSCK-RUETXSTFSA-N |
| XLogP | 2.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|