C18H25NO2S — CID 177305242
4-(3,4-dimethoxyphenyl)-3-propyl-3a,4,5,6,7,7a-hexahydrothieno[2,3-c]pyridine (PubChem CID 177305242) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-3-propyl-3a,4,5,6,7,7a-hexahydrothieno[2,3-c]pyridine.
| Compound Name | 4-(3,4-dimethoxyphenyl)-3-propyl-3a,4,5,6,7,7a-hexahydrothieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 177305242 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-3-propyl-3a,4,5,6,7,7a-hexahydrothieno[2,3-c]pyridine |
| SMILES | CCCC1=CSC2CNCC(c3ccc(OC)c(OC)c3)C12 |
| InChI | InChI=1S/C18H25NO2S/c1-4-5-13-11-22-17-10-19-9-14(18(13)17)12-6-7-15(20-2)16(8-12)21-3/h6-8,11,14,17-19H,4-5,9-10H2,1-3H3 |
| InChIKey | NCMHUPLFQFRRHE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |