C30H66N4O5Si2 — CID 177305282
N-[3-[[dimethoxy-[3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propyl]silyl]oxy-dimethoxysilyl]propyl]-1,2,2,6,6-pentamethylpiperidin-4-amine (PubChem CID 177305282) has the molecular formula C30H66N4O5Si2 and a molecular weight of 619.05 g/mol. Its IUPAC name is N-[3-[[dimethoxy-[3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propyl]silyl]oxy-dimethoxysilyl]propyl]-1,2,2,6,6-pentamethylpiperidin-4-amine.
| Compound Name | N-[3-[[dimethoxy-[3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propyl]silyl]oxy-dimethoxysilyl]propyl]-1,2,2,6,6-pentamethylpiperidin-4-amine |
|---|---|
| PubChem CID | 177305282 |
| Molecular Formula | C30H66N4O5Si2 |
| Molecular Weight | 619.05 g/mol |
| Exact Mass | 618.46 |
| IUPAC Name | N-[3-[[dimethoxy-[3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propyl]silyl]oxy-dimethoxysilyl]propyl]-1,2,2,6,6-pentamethylpiperidin-4-amine |
| SMILES | CO[Si](CCCNC1CC(C)(C)N(C)C(C)(C)C1)(OC)O[Si](CCCNC1CC(C)(C)N(C)C(C)(C)C1)(OC)OC |
| InChI | InChI=1S/C30H66N4O5Si2/c1-27(2)21-25(22-28(3,4)33(27)9)31-17-15-19-40(35-11,36-12)39-41(37-13,38-14)20-16-18-32-26-23-29(5,6)34(10)30(7,8)24-26/h25-26,31-32H,15-24H2,1-14H3 |
| InChIKey | URAFTOJKPVYJFI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.05 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|