C49H91N3O6 — CID 177305362
heptadecan-9-yl 8-[(6-heptan-2-yloxy-6-oxohexyl)-[2-hydroxy-6-(1H-pyrrole-3-carbonylamino)hexyl]amino]octanoate (PubChem CID 177305362) has the molecular formula C49H91N3O6 and a molecular weight of 818.28 g/mol. Its IUPAC name is heptadecan-9-yl 8-[(6-heptan-2-yloxy-6-oxohexyl)-[2-hydroxy-6-(1H-pyrrole-3-carbonylamino)hexyl]amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[(6-heptan-2-yloxy-6-oxohexyl)-[2-hydroxy-6-(1H-pyrrole-3-carbonylamino)hexyl]amino]octanoate |
|---|---|
| PubChem CID | 177305362 |
| Molecular Formula | C49H91N3O6 |
| Molecular Weight | 818.28 g/mol |
| Exact Mass | 817.69 |
| IUPAC Name | heptadecan-9-yl 8-[(6-heptan-2-yloxy-6-oxohexyl)-[2-hydroxy-6-(1H-pyrrole-3-carbonylamino)hexyl]amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCC(=O)OC(C)CCCCC)CC(O)CCCCNC(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C49H91N3O6/c1-5-8-11-13-16-22-32-46(33-23-17-14-12-9-6-2)58-48(55)35-24-18-15-19-28-39-52(40-29-20-25-34-47(54)57-43(4)30-21-10-7-3)42-45(53)31-26-27-37-51-49(56)44-36-38-50-41-44/h36,38,41,43,45-46,50,53H,5-35,37,39-40,42H2,1-4H3,(H,51,56) |
| InChIKey | FIHBSGKEFJXHDP-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.28 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|