About 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride
8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride (PubChem CID 177305511) has the molecular formula C16H15ClF3NO3
and a molecular weight of 361.75 g/mol. Its IUPAC name is 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride |
| PubChem CID | 177305511 |
| Molecular Formula | C16H15ClF3NO3 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride |
| SMILES | Cc1c(Oc2cccc(C(F)(F)F)c2)cc(N)c2c1OCCO2.Cl |
| InChI | InChI=1S/C16H14F3NO3.ClH/c1-9-13(8-12(20)15-14(9)21-5-6-22-15)23-11-4-2-3-10(7-11)16(17,18)19;/h2-4,7-8H,5-6,20H2,1H3;1H |
| InChIKey | NWHKFGQPEQQSDE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride?
The IUPAC name of 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride (CID 177305511) is 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride.
What is the SMILES notation for 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride?
The canonical SMILES for 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride is Cc1c(Oc2cccc(C(F)(F)F)c2)cc(N)c2c1OCCO2.Cl.
What is the InChIKey of 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride?
The InChIKey is NWHKFGQPEQQSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3NO3.ClH/c1-9-13(8-12(20)15-14(9)21-5-6-22-15)23-11-4-2-3-10(7-11)16(17,18)19;/h2-4,7-8H,5-6,20H2,1H3;1H.
What are the key properties of 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride?
8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride has a molecular weight of 361.75 g/mol, XLogP of 4.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride is sourced from PubChem (CID 177305511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).