C19H16Cl2N2O — CID 177306151
4-[8-(2,3-dichlorophenyl)quinolin-4-yl]morpholine (PubChem CID 177306151) has the molecular formula C19H16Cl2N2O and a molecular weight of 359.26 g/mol. Its IUPAC name is 4-[8-(2,3-dichlorophenyl)quinolin-4-yl]morpholine.
| Compound Name | 4-[8-(2,3-dichlorophenyl)quinolin-4-yl]morpholine |
|---|---|
| PubChem CID | 177306151 |
| Molecular Formula | C19H16Cl2N2O |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 4-[8-(2,3-dichlorophenyl)quinolin-4-yl]morpholine |
| SMILES | Clc1cccc(-c2cccc3c(N4CCOCC4)ccnc23)c1Cl |
| InChI | InChI=1S/C19H16Cl2N2O/c20-16-6-2-3-13(18(16)21)14-4-1-5-15-17(7-8-22-19(14)15)23-9-11-24-12-10-23/h1-8H,9-12H2 |
| InChIKey | YXYMKYOHSOYWKG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |