About [diethyl(dimethyl)-λ5-phosphanyl] benzoate
[diethyl(dimethyl)-λ5-phosphanyl] benzoate (PubChem CID 177306629) has the molecular formula C13H21O2P
and a molecular weight of 240.28 g/mol. Its IUPAC name is [diethyl(dimethyl)-λ5-phosphanyl] benzoate.
Molecular Properties
| Compound Name | [diethyl(dimethyl)-λ5-phosphanyl] benzoate |
| PubChem CID | 177306629 |
| Molecular Formula | C13H21O2P |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | [diethyl(dimethyl)-λ5-phosphanyl] benzoate |
| SMILES | CCP(C)(C)(CC)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H21O2P/c1-5-16(3,4,6-2)15-13(14)12-10-8-7-9-11-12/h7-11H,5-6H2,1-4H3 |
| InChIKey | WICGUJUGJOSDTJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [diethyl(dimethyl)-λ5-phosphanyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diethyl(dimethyl)-λ5-phosphanyl] benzoate?
The IUPAC name of [diethyl(dimethyl)-λ5-phosphanyl] benzoate (CID 177306629) is [diethyl(dimethyl)-λ5-phosphanyl] benzoate.
What is the SMILES notation for [diethyl(dimethyl)-λ5-phosphanyl] benzoate?
The canonical SMILES for [diethyl(dimethyl)-λ5-phosphanyl] benzoate is CCP(C)(C)(CC)OC(=O)c1ccccc1.
What is the InChIKey of [diethyl(dimethyl)-λ5-phosphanyl] benzoate?
The InChIKey is WICGUJUGJOSDTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21O2P/c1-5-16(3,4,6-2)15-13(14)12-10-8-7-9-11-12/h7-11H,5-6H2,1-4H3.
What are the key properties of [diethyl(dimethyl)-λ5-phosphanyl] benzoate?
[diethyl(dimethyl)-λ5-phosphanyl] benzoate has a molecular weight of 240.28 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [diethyl(dimethyl)-λ5-phosphanyl] benzoate is sourced from PubChem (CID 177306629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).