C14H16ClN5O — CID 177307063
4-(3-chloro-5-morpholin-3-ylphenyl)-6-methyl-1,3,5-triazin-2-amine (PubChem CID 177307063) has the molecular formula C14H16ClN5O and a molecular weight of 305.77 g/mol. Its IUPAC name is 4-(3-chloro-5-morpholin-3-ylphenyl)-6-methyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-chloro-5-morpholin-3-ylphenyl)-6-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 177307063 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 4-(3-chloro-5-morpholin-3-ylphenyl)-6-methyl-1,3,5-triazin-2-amine |
| SMILES | Cc1nc(N)nc(-c2cc(Cl)cc(C3COCCN3)c2)n1 |
| InChI | InChI=1S/C14H16ClN5O/c1-8-18-13(20-14(16)19-8)10-4-9(5-11(15)6-10)12-7-21-3-2-17-12/h4-6,12,17H,2-3,7H2,1H3,(H2,16,18,19,20) |
| InChIKey | IPTKAPCEKFGYJE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |