About 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine
6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine (PubChem CID 177307098) has the molecular formula C14H14ClF2N5O
and a molecular weight of 341.75 g/mol. Its IUPAC name is 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine |
| PubChem CID | 177307098 |
| Molecular Formula | C14H14ClF2N5O |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine |
| SMILES | Nc1cc(-c2cc([C@@H]3COC[C@@H](C(F)F)N3)cc(Cl)n2)ncn1 |
| InChI | InChI=1S/C14H14ClF2N5O/c15-12-2-7(10-4-23-5-11(21-10)14(16)17)1-9(22-12)8-3-13(18)20-6-19-8/h1-3,6,10-11,14,21H,4-5H2,(H2,18,19,20)/t10-,11-/m0/s1 |
| InChIKey | XSFGOYMGDVNQJN-QWRGUYRKSA-N |
| XLogP | 2.07 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine?
The IUPAC name of 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine (CID 177307098) is 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine.
What is the SMILES notation for 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine?
The canonical SMILES for 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine is Nc1cc(-c2cc([C@@H]3COC[C@@H](C(F)F)N3)cc(Cl)n2)ncn1.
What is the InChIKey of 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine?
The InChIKey is XSFGOYMGDVNQJN-QWRGUYRKSA-N. The full InChI is InChI=1S/C14H14ClF2N5O/c15-12-2-7(10-4-23-5-11(21-10)14(16)17)1-9(22-12)8-3-13(18)20-6-19-8/h1-3,6,10-11,14,21H,4-5H2,(H2,18,19,20)/t10-,11-/m0/s1.
What are the key properties of 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine?
6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine has a molecular weight of 341.75 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[6-chloro-4-[(3R,5S)-5-(difluoromethyl)morpholin-3-yl]-2-pyridinyl]pyrimidin-4-amine is sourced from PubChem (CID 177307098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).