C16H19N3O3 — CID 177308102
4-(3,5-dimethoxyphenoxy)-2-pyrrolidin-1-ylpyrimidine (PubChem CID 177308102) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenoxy)-2-pyrrolidin-1-ylpyrimidine.
| Compound Name | 4-(3,5-dimethoxyphenoxy)-2-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 177308102 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-(3,5-dimethoxyphenoxy)-2-pyrrolidin-1-ylpyrimidine |
| SMILES | COc1cc(OC)cc(Oc2ccnc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C16H19N3O3/c1-20-12-9-13(21-2)11-14(10-12)22-15-5-6-17-16(18-15)19-7-3-4-8-19/h5-6,9-11H,3-4,7-8H2,1-2H3 |
| InChIKey | KEFNQDJYCQHGKN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |