C21H14N2O2 — CID 177308189
4-phenyl-2,6-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7,9,11,13,15-hexaene-3,5-dione (PubChem CID 177308189) has the molecular formula C21H14N2O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 4-phenyl-2,6-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7,9,11,13,15-hexaene-3,5-dione.
| Compound Name | 4-phenyl-2,6-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7,9,11,13,15-hexaene-3,5-dione |
|---|---|
| PubChem CID | 177308189 |
| Molecular Formula | C21H14N2O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-phenyl-2,6-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7,9,11,13,15-hexaene-3,5-dione |
| SMILES | O=C1C(c2ccccc2)C(=O)N2c3ccccc3-c3ccccc3N12 |
| InChI | InChI=1S/C21H14N2O2/c24-20-19(14-8-2-1-3-9-14)21(25)23-18-13-7-5-11-16(18)15-10-4-6-12-17(15)22(20)23/h1-13,19H |
| InChIKey | SQLQLOGMGKZZSN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|