C22H23Cl2N9O — CID 177309235
2-[6-[(5,6-dichloro-1H-benzimidazol-2-yl)methylamino]-9-ethylpurin-2-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 177309235) has the molecular formula C22H23Cl2N9O and a molecular weight of 500.39 g/mol. Its IUPAC name is 2-[6-[(5,6-dichloro-1H-benzimidazol-2-yl)methylamino]-9-ethylpurin-2-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-[6-[(5,6-dichloro-1H-benzimidazol-2-yl)methylamino]-9-ethylpurin-2-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 177309235 |
| Molecular Formula | C22H23Cl2N9O |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 2-[6-[(5,6-dichloro-1H-benzimidazol-2-yl)methylamino]-9-ethylpurin-2-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | CCn1cnc2c(NCc3nc4cc(Cl)c(Cl)cc4[nH]3)nc(N3CCN4C(=O)CCC4C3)nc21 |
| InChI | InChI=1S/C22H23Cl2N9O/c1-2-31-11-26-19-20(25-9-17-27-15-7-13(23)14(24)8-16(15)28-17)29-22(30-21(19)31)32-5-6-33-12(10-32)3-4-18(33)34/h7-8,11-12H,2-6,9-10H2,1H3,(H,27,28)(H,25,29,30) |
| InChIKey | QDYPLRGNSOEQOY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |