C17H25N3S — CID 177310021
5-[1-[(2R,5S)-2,5-diethylpiperazin-1-yl]ethyl]-2,1-benzothiazole (PubChem CID 177310021) has the molecular formula C17H25N3S and a molecular weight of 303.48 g/mol. Its IUPAC name is 5-[1-[(2R,5S)-2,5-diethylpiperazin-1-yl]ethyl]-2,1-benzothiazole.
| Compound Name | 5-[1-[(2R,5S)-2,5-diethylpiperazin-1-yl]ethyl]-2,1-benzothiazole |
|---|---|
| PubChem CID | 177310021 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 5-[1-[(2R,5S)-2,5-diethylpiperazin-1-yl]ethyl]-2,1-benzothiazole |
| SMILES | CC[C@H]1CN(C(C)c2ccc3nscc3c2)[C@H](CC)CN1 |
| InChI | InChI=1S/C17H25N3S/c1-4-15-10-20(16(5-2)9-18-15)12(3)13-6-7-17-14(8-13)11-21-19-17/h6-8,11-12,15-16,18H,4-5,9-10H2,1-3H3/t12?,15-,16+/m0/s1 |
| InChIKey | QBKACJXXOWZQGA-FFPFEORLSA-N |
| XLogP | 3.82 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |