C12H13N3O — CID 177310133
7,8-dimethyl-4,9,13-triazatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,11-tetraen-10-one (PubChem CID 177310133) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 7,8-dimethyl-4,9,13-triazatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,11-tetraen-10-one.
| Compound Name | 7,8-dimethyl-4,9,13-triazatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,11-tetraen-10-one |
|---|---|
| PubChem CID | 177310133 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 7,8-dimethyl-4,9,13-triazatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,11-tetraen-10-one |
| SMILES | Cc1c2c(c3nccc(=O)n3c1C)CNC2 |
| InChI | InChI=1S/C12H13N3O/c1-7-8(2)15-11(16)3-4-14-12(15)10-6-13-5-9(7)10/h3-4,13H,5-6H2,1-2H3 |
| InChIKey | VSQZRWOHKPKQMI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |