C14H15ClN2O6 — CID 177311265
(E)-3-(5-chloro-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid (PubChem CID 177311265) has the molecular formula C14H15ClN2O6 and a molecular weight of 342.74 g/mol. Its IUPAC name is (E)-3-(5-chloro-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid.
| Compound Name | (E)-3-(5-chloro-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 177311265 |
| Molecular Formula | C14H15ClN2O6 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (E)-3-(5-chloro-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=C/c1cc(Cl)ccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C14H15ClN2O6/c1-14(2,3)23-13(20)16-10(12(18)19)7-8-6-9(15)4-5-11(8)17(21)22/h4-7H,1-3H3,(H,16,20)(H,18,19)/b10-7+ |
| InChIKey | XZBTVBWEURXJTG-JXMROGBWSA-N |
| XLogP | 3.20 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|