About 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine
1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine (PubChem CID 177311389) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine |
| PubChem CID | 177311389 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine |
| SMILES | C=CCNCC(NCC=C)OCC |
| InChI | InChI=1S/C10H20N2O/c1-4-7-11-9-10(13-6-3)12-8-5-2/h4-5,10-12H,1-2,6-9H2,3H3 |
| InChIKey | YFKQLLUTEVNBLB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine?
The IUPAC name of 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine (CID 177311389) is 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine.
What is the SMILES notation for 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine?
The canonical SMILES for 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine is C=CCNCC(NCC=C)OCC.
What is the InChIKey of 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine?
The InChIKey is YFKQLLUTEVNBLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-4-7-11-9-10(13-6-3)12-8-5-2/h4-5,10-12H,1-2,6-9H2,3H3.
What are the key properties of 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine?
1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine has a molecular weight of 184.28 g/mol, XLogP of 0.90, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-N,N'-bis(prop-2-enyl)ethane-1,2-diamine is sourced from PubChem (CID 177311389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).