About 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one
3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one (PubChem CID 177311772) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one |
| PubChem CID | 177311772 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one |
| SMILES | COc1cc2c(cc1OC)C(C1CCC1)NC2=O |
| InChI | InChI=1S/C14H17NO3/c1-17-11-6-9-10(7-12(11)18-2)14(16)15-13(9)8-4-3-5-8/h6-8,13H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | JCCGIOYIWZSLGY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one?
The IUPAC name of 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one (CID 177311772) is 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one?
The canonical SMILES for 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one is COc1cc2c(cc1OC)C(C1CCC1)NC2=O.
What is the InChIKey of 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one?
The InChIKey is JCCGIOYIWZSLGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3/c1-17-11-6-9-10(7-12(11)18-2)14(16)15-13(9)8-4-3-5-8/h6-8,13H,3-5H2,1-2H3,(H,15,16).
What are the key properties of 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one?
3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one has a molecular weight of 247.29 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutyl-5,6-dimethoxy-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 177311772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).