C21H20F2N4O5 — CID 177311956
dimethyl 2-[3-cyano-6-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]propanedioate (PubChem CID 177311956) has the molecular formula C21H20F2N4O5 and a molecular weight of 446.41 g/mol. Its IUPAC name is dimethyl 2-[3-cyano-6-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]propanedioate.
| Compound Name | dimethyl 2-[3-cyano-6-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]propanedioate |
|---|---|
| PubChem CID | 177311956 |
| Molecular Formula | C21H20F2N4O5 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | dimethyl 2-[3-cyano-6-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)c1nc(N2CCC(Oc3ccc(F)cc3F)CC2)cnc1C#N |
| InChI | InChI=1S/C21H20F2N4O5/c1-30-20(28)18(21(29)31-2)19-15(10-24)25-11-17(26-19)27-7-5-13(6-8-27)32-16-4-3-12(22)9-14(16)23/h3-4,9,11,13,18H,5-8H2,1-2H3 |
| InChIKey | KVVHMJGUDKCTLY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 114.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|