About 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one
6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 177312067) has the molecular formula C13H16ClNO
and a molecular weight of 237.73 g/mol. Its IUPAC name is 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 177312067 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | CC(C)(C)c1cc2c(cc1Cl)C(=O)NCC2 |
| InChI | InChI=1S/C13H16ClNO/c1-13(2,3)10-6-8-4-5-15-12(16)9(8)7-11(10)14/h6-7H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | BTOYUKKYYHURAM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one (CID 177312067) is 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one is CC(C)(C)c1cc2c(cc1Cl)C(=O)NCC2.
What is the InChIKey of 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is BTOYUKKYYHURAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO/c1-13(2,3)10-6-8-4-5-15-12(16)9(8)7-11(10)14/h6-7H,4-5H2,1-3H3,(H,15,16).
What are the key properties of 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one?
6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 237.73 g/mol, XLogP of 2.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-7-chloro-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 177312067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).