About 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde
3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde (PubChem CID 177312110) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde.
Molecular Properties
| Compound Name | 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde |
| PubChem CID | 177312110 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde |
| SMILES | O=Cc1c[nH]c2ccc3c(c12)COC3 |
| InChI | InChI=1S/C11H9NO2/c13-4-8-3-12-10-2-1-7-5-14-6-9(7)11(8)10/h1-4,12H,5-6H2 |
| InChIKey | YMSPQXQQWCQNTN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde?
The IUPAC name of 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde (CID 177312110) is 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde.
What is the SMILES notation for 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde?
The canonical SMILES for 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde is O=Cc1c[nH]c2ccc3c(c12)COC3.
What is the InChIKey of 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde?
The InChIKey is YMSPQXQQWCQNTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c13-4-8-3-12-10-2-1-7-5-14-6-9(7)11(8)10/h1-4,12H,5-6H2.
What are the key properties of 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde?
3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde has a molecular weight of 187.20 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dihydro-1H-furo[3,4-e]indole-8-carbaldehyde is sourced from PubChem (CID 177312110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).