C28H30O9 — CID 177312136
dimethyl 6-[[6,7-bis(methoxycarbonyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate (PubChem CID 177312136) has the molecular formula C28H30O9 and a molecular weight of 510.54 g/mol. Its IUPAC name is dimethyl 6-[[6,7-bis(methoxycarbonyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl 6-[[6,7-bis(methoxycarbonyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 177312136 |
| Molecular Formula | C28H30O9 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | dimethyl 6-[[6,7-bis(methoxycarbonyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate |
| SMILES | COC(=O)C1Cc2ccc(Oc3ccc4c(c3)CC(C(=O)OC)C(C(=O)OC)C4)cc2CC1C(=O)OC |
| InChI | InChI=1S/C28H30O9/c1-33-25(29)21-11-15-5-7-19(9-17(15)13-23(21)27(31)35-3)37-20-8-6-16-12-22(26(30)34-2)24(28(32)36-4)14-18(16)10-20/h5-10,21-24H,11-14H2,1-4H3 |
| InChIKey | KIBHHRIQFPRHBP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|