C16H12ClN3O — CID 177312596
8-chloro-N-(2,3-dihydro-1-benzofuran-6-yl)quinazolin-2-amine (PubChem CID 177312596) has the molecular formula C16H12ClN3O and a molecular weight of 297.75 g/mol. Its IUPAC name is 8-chloro-N-(2,3-dihydro-1-benzofuran-6-yl)quinazolin-2-amine.
| Compound Name | 8-chloro-N-(2,3-dihydro-1-benzofuran-6-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 177312596 |
| Molecular Formula | C16H12ClN3O |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 8-chloro-N-(2,3-dihydro-1-benzofuran-6-yl)quinazolin-2-amine |
| SMILES | Clc1cccc2cnc(Nc3ccc4c(c3)OCC4)nc12 |
| InChI | InChI=1S/C16H12ClN3O/c17-13-3-1-2-11-9-18-16(20-15(11)13)19-12-5-4-10-6-7-21-14(10)8-12/h1-5,8-9H,6-7H2,(H,18,19,20) |
| InChIKey | DYXPCPVVVDHISH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |