C9H14ClF4NO — CID 177313187
3-chloro-N,N-diethyl-3,4,4,4-tetrafluoro-2-methylbutanamide (PubChem CID 177313187) has the molecular formula C9H14ClF4NO and a molecular weight of 263.66 g/mol. Its IUPAC name is 3-chloro-N,N-diethyl-3,4,4,4-tetrafluoro-2-methylbutanamide.
| Compound Name | 3-chloro-N,N-diethyl-3,4,4,4-tetrafluoro-2-methylbutanamide |
|---|---|
| PubChem CID | 177313187 |
| Molecular Formula | C9H14ClF4NO |
| Molecular Weight | 263.66 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-chloro-N,N-diethyl-3,4,4,4-tetrafluoro-2-methylbutanamide |
| SMILES | CCN(CC)C(=O)C(C)C(F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C9H14ClF4NO/c1-4-15(5-2)7(16)6(3)8(10,11)9(12,13)14/h6H,4-5H2,1-3H3 |
| InChIKey | XZSFSYUYTWQULV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|