C20H28N4O5S — CID 177313631
ethyl [6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-4-yl]methanesulfonate (PubChem CID 177313631) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is ethyl [6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-4-yl]methanesulfonate.
| Compound Name | ethyl [6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-4-yl]methanesulfonate |
|---|---|
| PubChem CID | 177313631 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | ethyl [6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1-(oxan-2-yl)pyrazolo[5,4-b]pyridin-4-yl]methanesulfonate |
| SMILES | CCOS(=O)(=O)Cc1cc(N2C3CCC2COC3)nc2c1cnn2C1CCCCO1 |
| InChI | InChI=1S/C20H28N4O5S/c1-2-29-30(25,26)13-14-9-18(23-15-6-7-16(23)12-27-11-15)22-20-17(14)10-21-24(20)19-5-3-4-8-28-19/h9-10,15-16,19H,2-8,11-13H2,1H3 |
| InChIKey | DPIWWIZINXTFKQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|