About (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile
(Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile (PubChem CID 177314227) has the molecular formula C22H18N2O3S
and a molecular weight of 390.46 g/mol. Its IUPAC name is (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile |
| PubChem CID | 177314227 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(OCCCS)cc1)c1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C22H18N2O3S/c23-15-18(14-16-2-8-20(9-3-16)27-12-1-13-28)17-4-6-19(7-5-17)24-21(25)10-11-22(24)26/h2-11,14,28H,1,12-13H2/b18-14+ |
| InChIKey | AKQJEAIAGLJXPH-NBVRZTHBSA-N |
| XLogP | 3.88 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile?
The IUPAC name of (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile (CID 177314227) is (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile.
What is the SMILES notation for (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile?
The canonical SMILES for (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile is N#C/C(=C\c1ccc(OCCCS)cc1)c1ccc(N2C(=O)C=CC2=O)cc1.
What is the InChIKey of (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile?
The InChIKey is AKQJEAIAGLJXPH-NBVRZTHBSA-N. The full InChI is InChI=1S/C22H18N2O3S/c23-15-18(14-16-2-8-20(9-3-16)27-12-1-13-28)17-4-6-19(7-5-17)24-21(25)10-11-22(24)26/h2-11,14,28H,1,12-13H2/b18-14+.
What are the key properties of (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile?
(Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile has a molecular weight of 390.46 g/mol, XLogP of 3.88, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-[4-(3-sulfanylpropoxy)phenyl]prop-2-enenitrile is sourced from PubChem (CID 177314227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).