About ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide
ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide (PubChem CID 177314302) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide |
| PubChem CID | 177314302 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide |
| SMILES | CC.NC(=O)CC1(O)C=CC(=O)C=C1 |
| InChI | InChI=1S/C8H9NO3.C2H6/c9-7(11)5-8(12)3-1-6(10)2-4-8;1-2/h1-4,12H,5H2,(H2,9,11);1-2H3 |
| InChIKey | GWXPOGIKNOOZGQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide?
The IUPAC name of ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide (CID 177314302) is ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide.
What is the SMILES notation for ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide?
The canonical SMILES for ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide is CC.NC(=O)CC1(O)C=CC(=O)C=C1.
What is the InChIKey of ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide?
The InChIKey is GWXPOGIKNOOZGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3.C2H6/c9-7(11)5-8(12)3-1-6(10)2-4-8;1-2/h1-4,12H,5H2,(H2,9,11);1-2H3.
What are the key properties of ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide?
ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide has a molecular weight of 197.23 g/mol, XLogP of 0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide is sourced from PubChem (CID 177314302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).