C24H18ClN5O3S — CID 177314430
3-chloro-N-[1-[3-(5-cyano-2-pyridinyl)quinoxalin-2-yl]ethyl]-5-methylsulfonylbenzamide (PubChem CID 177314430) has the molecular formula C24H18ClN5O3S and a molecular weight of 491.96 g/mol. Its IUPAC name is 3-chloro-N-[1-[3-(5-cyano-2-pyridinyl)quinoxalin-2-yl]ethyl]-5-methylsulfonylbenzamide.
| Compound Name | 3-chloro-N-[1-[3-(5-cyano-2-pyridinyl)quinoxalin-2-yl]ethyl]-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 177314430 |
| Molecular Formula | C24H18ClN5O3S |
| Molecular Weight | 491.96 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 3-chloro-N-[1-[3-(5-cyano-2-pyridinyl)quinoxalin-2-yl]ethyl]-5-methylsulfonylbenzamide |
| SMILES | CC(NC(=O)c1cc(Cl)cc(S(C)(=O)=O)c1)c1nc2ccccc2nc1-c1ccc(C#N)cn1 |
| InChI | InChI=1S/C24H18ClN5O3S/c1-14(28-24(31)16-9-17(25)11-18(10-16)34(2,32)33)22-23(21-8-7-15(12-26)13-27-21)30-20-6-4-3-5-19(20)29-22/h3-11,13-14H,1-2H3,(H,28,31) |
| InChIKey | GMTLWDJYOHDBPR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.96 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |