About ethane;4-methylsulfanylaniline;oxolan-2-one
ethane;4-methylsulfanylaniline;oxolan-2-one (PubChem CID 177314744) has the molecular formula C13H21NO2S
and a molecular weight of 255.38 g/mol. Its IUPAC name is ethane;4-methylsulfanylaniline;oxolan-2-one.
Molecular Properties
| Compound Name | ethane;4-methylsulfanylaniline;oxolan-2-one |
| PubChem CID | 177314744 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | ethane;4-methylsulfanylaniline;oxolan-2-one |
| SMILES | CC.CSc1ccc(N)cc1.O=C1CCCO1 |
| InChI | InChI=1S/C7H9NS.C4H6O2.C2H6/c1-9-7-4-2-6(8)3-5-7;5-4-2-1-3-6-4;1-2/h2-5H,8H2,1H3;1-3H2;1-2H3 |
| InChIKey | PYRTYGNIDNSMFN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methylsulfanylaniline;oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methylsulfanylaniline;oxolan-2-one?
The IUPAC name of ethane;4-methylsulfanylaniline;oxolan-2-one (CID 177314744) is ethane;4-methylsulfanylaniline;oxolan-2-one.
What is the SMILES notation for ethane;4-methylsulfanylaniline;oxolan-2-one?
The canonical SMILES for ethane;4-methylsulfanylaniline;oxolan-2-one is CC.CSc1ccc(N)cc1.O=C1CCCO1.
What is the InChIKey of ethane;4-methylsulfanylaniline;oxolan-2-one?
The InChIKey is PYRTYGNIDNSMFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NS.C4H6O2.C2H6/c1-9-7-4-2-6(8)3-5-7;5-4-2-1-3-6-4;1-2/h2-5H,8H2,1H3;1-3H2;1-2H3.
What are the key properties of ethane;4-methylsulfanylaniline;oxolan-2-one?
ethane;4-methylsulfanylaniline;oxolan-2-one has a molecular weight of 255.38 g/mol, XLogP of 3.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methylsulfanylaniline;oxolan-2-one is sourced from PubChem (CID 177314744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).